CAS 1211530-60-7

Methyl 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine-2-carboxylate

Description:

Methyl 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine-2-carboxylate is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyrimidine rings. This compound typically exhibits a range of chemical properties, including moderate solubility in polar organic solvents due to the presence of the carboxylate group. It may participate in various chemical reactions, such as nucleophilic substitutions and cycloadditions, owing to the electron-rich nature of the nitrogen atoms in its rings. The presence of the methyl ester functional group contributes to its reactivity and potential applications in organic synthesis. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential interactions with biological targets, which could be explored in pharmacological studies. Overall, Methyl 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine-2-carboxylate represents a versatile scaffold for further chemical exploration and application in various fields.

Formula: C₈H₉N₃O₂

InChI: InChI=1S/C8H9N3O2/c1-13-8(12)7-10-3-5-2-9-4-6(5)11-7/h3,9H,2,4H2,1H3

InChI key: InChIKey=ZJHBTWZBFFECET-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1N=C2C(=CN1)CNC2

Synonyms:

• 5H-Pyrrolo[3,4-d]pyrimidine-2-carboxylic acid, 6,7-dihydro-, methyl ester
• Methyl 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine-2-carboxylate