
CAS 1211530-64-1
:Pyrimidine, 5-(chloromethyl)-2-cyclopropyl-
Description:
Pyrimidine, 5-(chloromethyl)-2-cyclopropyl- is a heterocyclic organic compound characterized by a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chloromethyl group at the 5-position introduces a reactive site, making it useful in various chemical reactions, particularly in the synthesis of more complex molecules. The cyclopropyl group at the 2-position contributes to the compound's unique steric and electronic properties, potentially influencing its reactivity and interactions with biological targets. Pyrimidine derivatives are often studied for their pharmacological activities, including antiviral and anticancer properties. The compound's physical properties, such as solubility and boiling point, can vary based on its molecular structure and substituents. As with many pyrimidine derivatives, it may exhibit moderate to high lipophilicity, affecting its bioavailability and distribution in biological systems. Safety and handling precautions should be observed due to the presence of the chloromethyl group, which can be reactive and potentially hazardous.
Formula:C8H9ClN2
InChI:InChI=1S/C8H9ClN2/c9-3-6-4-10-8(11-5-6)7-1-2-7/h4-5,7H,1-3H2
InChI key:InChIKey=MKQYVUJESGXNBT-UHFFFAOYSA-N
SMILES:C(Cl)C=1C=NC(=NC1)C2CC2
Synonyms:- 5-Chloromethyl-2-cyclopropylpyrimidine
- Pyrimidine, 5-(chloromethyl)-2-cyclopropyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.