CAS 1211532-42-1
:2,3-Dihydro-5-(trifluoromethoxy)-1H-isoindole
Description:
2,3-Dihydro-5-(trifluoromethoxy)-1H-isoindole is a heterocyclic organic compound characterized by its isoindole structure, which consists of a fused benzene and pyrrole ring. This compound features a trifluoromethoxy group, which significantly influences its chemical properties, including increased lipophilicity and potential reactivity due to the presence of electronegative fluorine atoms. The dihydro form indicates that it has two hydrogen atoms added to the isoindole framework, which can affect its stability and reactivity. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and drug development. Its unique structure allows for potential interactions with biological targets, and the trifluoromethoxy group can enhance metabolic stability. Additionally, the presence of fluorine can improve the compound's pharmacokinetic properties. Overall, 2,3-Dihydro-5-(trifluoromethoxy)-1H-isoindole represents a valuable scaffold for further research and development in various chemical and pharmaceutical applications.
Formula:C9H8F3NO
InChI:InChI=1S/C9H8F3NO/c10-9(11,12)14-8-2-1-6-4-13-5-7(6)3-8/h1-3,13H,4-5H2
InChI key:InChIKey=ZQVQHJSIHQKWLY-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C=1C=C2C(=CC1)CNC2
Synonyms:- 2,3-Dihydro-5-(trifluoromethoxy)-1H-isoindole
- 1H-Isoindole, 2,3-dihydro-5-(trifluoromethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.