
CAS 1211533-68-4
:1-(5-Nitro-3-pyridinyl)piperazine
Description:
1-(5-Nitro-3-pyridinyl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a nitro group and a pyridine ring at the 1-position of the piperazine structure contributes to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in polar solvents, which is common for many piperazine derivatives. It may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting neurological or psychiatric conditions. The nitro group can influence the compound's reactivity and potential interactions with biological targets. Additionally, the presence of the pyridine ring can enhance lipophilicity, affecting the compound's pharmacokinetics. Safety and handling precautions are essential, as nitro compounds can be sensitive and may pose health risks. Overall, 1-(5-Nitro-3-pyridinyl)piperazine is a compound of interest in medicinal chemistry due to its structural features and potential applications.
Formula:C9H12N4O2
InChI:InChI=1S/C9H12N4O2/c14-13(15)9-5-8(6-11-7-9)12-3-1-10-2-4-12/h5-7,10H,1-4H2
InChI key:InChIKey=WDNKAEMQYMGFRN-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CC(=CN=C1)N2CCNCC2
Synonyms:- 1-(5-Nitro-3-pyridinyl)piperazine
- Piperazine, 1-(5-nitro-3-pyridinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.