CAS 1211533-84-4

Piperazine, 1-[(3-chloro-4-pyridinyl)methyl]-

Description:

Piperazine, 1-[(3-chloro-4-pyridinyl)methyl]- is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a 3-chloro-4-pyridinyl group attached to a methyl group, contributing to its unique properties and potential biological activity. It is typically a white to off-white solid and is soluble in polar solvents, which may enhance its bioavailability in pharmaceutical applications. The presence of the chloro and pyridine functionalities suggests potential interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its molecular structure allows for various chemical reactions, including substitutions and modifications, which can be explored for enhancing its efficacy or reducing toxicity. As with many piperazine derivatives, it may exhibit a range of pharmacological effects, including anxiolytic, antidepressant, or antipsychotic activities, depending on its specific interactions within biological systems. Safety and handling precautions should be observed due to its potential biological activity.

Formula: C₁₀H₁₄ClN₃

InChI: InChI=1S/C10H14ClN3/c11-10-7-13-2-1-9(10)8-14-5-3-12-4-6-14/h1-2,7,12H,3-6,8H2

InChI key: InChIKey=XXWRZYDIJRYVPI-UHFFFAOYSA-N

SMILES: C(C=1C(Cl)=CN=CC1)N2CCNCC2

Synonyms:

• 1-[(3-Chloropyridin-4-yl)methyl]piperazine
• Piperazine, 1-[(3-chloro-4-pyridinyl)methyl]-