CAS 1211534-09-6
:5-Bromo-4-methyl-3-pyridinemethanamine
Description:
5-Bromo-4-methyl-3-pyridinemethanamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 5-position and a methyl group at the 4-position of the pyridine ring contributes to its unique chemical properties. The methanamine functional group attached to the 3-position of the pyridine ring indicates that it contains an amine group, which can participate in hydrogen bonding and may influence its reactivity and solubility in various solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the presence of halogen and amine functionalities can affect its physical properties, such as melting point, boiling point, and reactivity with other chemical species. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C7H9BrN2
InChI:InChI=1S/C7H9BrN2/c1-5-6(2-9)3-10-4-7(5)8/h3-4H,2,9H2,1H3
InChI key:InChIKey=JXRSJDBBLGQHLJ-UHFFFAOYSA-N
SMILES:C(N)C=1C(C)=C(Br)C=NC1
Synonyms:- 5-Bromo-4-methyl-3-pyridinemethanamine
- 3-Pyridinemethanamine, 5-bromo-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.