CymitQuimica logo

CAS 1211534-22-3

:

5-Methyl-3-(trifluoromethyl)-2-pyridinemethanamine

Description:
5-Methyl-3-(trifluoromethyl)-2-pyridinemethanamine, identified by its CAS number 1211534-22-3, is an organic compound belonging to the class of pyridine derivatives. This substance features a pyridine ring substituted with a methyl group and a trifluoromethyl group, which significantly influences its chemical properties and reactivity. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can affect its biological activity, making it of interest in pharmaceutical research. The amine functional group in the structure suggests potential basicity and reactivity with acids, allowing for the formation of salts. Additionally, the compound may exhibit unique interactions due to the electron-withdrawing nature of the trifluoromethyl group, which can stabilize certain reaction intermediates. Overall, 5-Methyl-3-(trifluoromethyl)-2-pyridinemethanamine is a compound of interest in various fields, including medicinal chemistry and materials science, due to its distinctive structural features and potential applications.
Formula:C8H9F3N2
InChI:InChI=1S/C8H9F3N2/c1-5-2-6(8(9,10)11)7(3-12)13-4-5/h2,4H,3,12H2,1H3
InChI key:InChIKey=FVWCMBDLVCBIEE-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(CN)N=CC(C)=C1
Synonyms:
  • [5-Methyl-3-(trifluoromethyl)pyridin-2-yl]methanamine
  • 5-Methyl-3-(trifluoromethyl)-2-pyridinemethanamine
  • 2-Pyridinemethanamine, 5-methyl-3-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.