CymitQuimica logo

CAS 1211536-59-2

:

2-Chloro-3-ethynyl-5-(trifluoromethyl)pyridine

Description:
2-Chloro-3-ethynyl-5-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chloro group at the 2-position and a trifluoromethyl group at the 5-position contributes to its unique chemical properties, including increased lipophilicity and potential reactivity. The ethynyl group at the 3-position introduces a triple bond, which can participate in various chemical reactions, such as nucleophilic additions or coupling reactions. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its trifluoromethyl group enhances its biological activity and stability, making it of interest in medicinal chemistry. Additionally, the presence of halogens can influence the compound's solubility and reactivity, making it a valuable building block in the development of more complex molecules. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated compounds.
Formula:C8H3ClF3N
InChI:InChI=1S/C8H3ClF3N/c1-2-5-3-6(8(10,11)12)4-13-7(5)9/h1,3-4H
InChI key:InChIKey=CUAHQAUDWAQJHY-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=C(C#C)C(Cl)=NC1
Synonyms:
  • 2-Chloro-3-ethynyl-5-(trifluoromethyl)pyridine
  • Pyridine, 2-chloro-3-ethynyl-5-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.