CAS 1211536-78-5

2-[1-[(1,1-Dimethylethoxy)carbonyl]-4-piperidinyl]-5-pyrimidinecarboxylic acid

Description:

2-[1-[(1,1-Dimethylethoxy)carbonyl]-4-piperidinyl]-5-pyrimidinecarboxylic acid, identified by its CAS number 1211536-78-5, is a chemical compound that features a complex structure incorporating both piperidine and pyrimidine moieties. This compound is characterized by its carboxylic acid functional group, which contributes to its acidity and potential reactivity in various chemical environments. The presence of the 1,1-dimethylethoxycarbonyl group indicates that it may have protective or modifying properties, often utilized in synthetic organic chemistry. The piperidine ring adds to the compound's potential biological activity, as piperidine derivatives are frequently found in pharmaceuticals. Additionally, the pyrimidine ring can participate in hydrogen bonding and π-π interactions, influencing the compound's solubility and stability. Overall, this compound's unique structural features suggest it may have applications in medicinal chemistry, particularly in the development of new therapeutic agents. Its specific properties, such as solubility, melting point, and reactivity, would require empirical investigation for precise characterization.

Formula: C₁₅H₂₁N₃O₄

InChI: InChI=1S/C15H21N3O4/c1-15(2,3)22-14(21)18-6-4-10(5-7-18)12-16-8-11(9-17-12)13(19)20/h8-10H,4-7H2,1-3H3,(H,19,20)

InChI key: InChIKey=NCOWCONSLLIYGE-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CCC(CC1)C=2N=CC(C(O)=O)=CN2

Synonyms:

• 5-Pyrimidinecarboxylic acid, 2-[1-[(1,1-dimethylethoxy)carbonyl]-4-piperidinyl]-
• 2-[1-[(1,1-Dimethylethoxy)carbonyl]-4-piperidinyl]-5-pyrimidinecarboxylic acid