CymitQuimica logo

CAS 1211537-24-4

:

6-Chloropyrido[3,2-d]pyrimidine

Description:
6-Chloropyrido[3,2-d]pyrimidine is a heterocyclic organic compound characterized by a fused ring system that incorporates both pyridine and pyrimidine structures. The presence of a chlorine atom at the 6-position of the pyridine ring contributes to its reactivity and potential applications in medicinal chemistry. This compound typically exhibits a pale yellow to off-white crystalline appearance and is soluble in organic solvents. Its molecular structure allows for various interactions, making it a candidate for use in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. The compound's unique electronic properties, influenced by the halogen substitution, can affect its biological activity and binding affinity to target proteins. Additionally, 6-Chloropyrido[3,2-d]pyrimidine may serve as a building block in the synthesis of more complex molecules, highlighting its importance in organic synthesis and drug discovery. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C7H4ClN3
InChI:InChI=1S/C7H4ClN3/c8-7-2-1-5-6(11-7)3-9-4-10-5/h1-4H
InChI key:InChIKey=MAVLIYYHMISCSU-UHFFFAOYSA-N
SMILES:ClC1=NC2=C(C=C1)N=CN=C2
Synonyms:
  • 6-Chloropyrido[3,2-d]pyrimidine
  • Pyrido[3,2-d]pyrimidine, 6-chloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.