
CAS 1211537-54-0
:5-Amino-6-chloro-3-pyridinol
Description:
5-Amino-6-chloro-3-pyridinol is a heterocyclic organic compound characterized by its pyridine ring structure, which includes an amino group and a chlorine substituent. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The chlorine atom introduces a halogen functionality that can influence the compound's reactivity and potential applications in medicinal chemistry. As a pyridinol derivative, it may exhibit biological activity, making it of interest in pharmaceutical research. The presence of both amino and chloro groups suggests potential for further chemical modifications, which could enhance its pharmacological properties. Additionally, its molecular structure allows for various synthetic pathways, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C5H5ClN2O
InChI:InChI=1S/C5H5ClN2O/c6-5-4(7)1-3(9)2-8-5/h1-2,9H,7H2
InChI key:InChIKey=NIHCHQIYMOEGEF-UHFFFAOYSA-N
SMILES:NC1=C(Cl)N=CC(O)=C1
Synonyms:- 3-Pyridinol, 5-amino-6-chloro-
- 5-Amino-6-chloro-3-pyridinol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
