
CAS 1211539-79-5
:3-(2,3-Dimethoxyphenyl)morpholine
Description:
3-(2,3-Dimethoxyphenyl)morpholine is an organic compound characterized by its morpholine ring, which is a six-membered heterocyclic structure containing one nitrogen atom. The presence of the 2,3-dimethoxyphenyl group indicates that the compound has two methoxy (-OCH3) substituents on a phenyl ring, which can influence its solubility, reactivity, and biological activity. This compound is likely to exhibit moderate polarity due to the methoxy groups, which can enhance its solubility in organic solvents while also allowing for potential interactions with biological targets. Morpholine derivatives are often studied for their pharmacological properties, including potential applications in medicinal chemistry. The specific arrangement of substituents can affect the compound's electronic properties and steric hindrance, which are crucial for its interaction with enzymes or receptors. Overall, 3-(2,3-Dimethoxyphenyl)morpholine is a compound of interest in both synthetic organic chemistry and pharmaceutical research, warranting further investigation into its properties and potential applications.
Formula:C12H17NO3
InChI:InChI=1S/C12H17NO3/c1-14-11-5-3-4-9(12(11)15-2)10-8-16-7-6-13-10/h3-5,10,13H,6-8H2,1-2H3
InChI key:InChIKey=CRSIHVDZBIILBE-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC=C1OC)C2COCCN2
Synonyms:- 3-(2,3-Dimethoxyphenyl)morpholine
- Morpholine, 3-(2,3-dimethoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.