
CAS 1211539-90-0
:α,α,5-Trimethyl-3-pyridinemethanamine
Description:
α,α,5-Trimethyl-3-pyridinemethanamine, identified by its CAS number 1211539-90-0, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features three methyl groups attached to the alpha positions of the pyridine, contributing to its steric and electronic properties. The presence of the amine functional group indicates that it can participate in hydrogen bonding, making it potentially soluble in polar solvents. Its structure suggests that it may exhibit basic properties due to the nitrogen atom, which can accept protons. The compound's unique arrangement of substituents may influence its reactivity, making it of interest in various chemical applications, including synthesis and as a potential ligand in coordination chemistry. Additionally, the presence of multiple methyl groups can enhance hydrophobic interactions, affecting its behavior in biological systems or industrial processes. Overall, α,α,5-Trimethyl-3-pyridinemethanamine is a compound with distinctive structural features that may impart specific chemical and physical properties.
Formula:C9H14N2
InChI:InChI=1S/C9H14N2/c1-7-4-8(6-11-5-7)9(2,3)10/h4-6H,10H2,1-3H3
InChI key:InChIKey=ZVIOTJTVPCZGKL-UHFFFAOYSA-N
SMILES:C(C)(C)(N)C=1C=C(C)C=NC1
Synonyms:- 3-Pyridinemethanamine, α,α,5-trimethyl-
- α,α,5-Trimethyl-3-pyridinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.