CymitQuimica logo

CAS 1211541-45-5

:

Methyl 2-cyano-5-thiazolecarboxylate

Description:
Methyl 2-cyano-5-thiazolecarboxylate is a chemical compound characterized by its thiazole ring, which contributes to its unique reactivity and properties. This compound features a cyano group (-CN) and a carboxylate ester (-COOCH3) functional group, which enhance its potential for various chemical reactions, including nucleophilic substitutions and cycloadditions. The presence of the thiazole moiety imparts notable biological activity, making it of interest in pharmaceutical research. Methyl 2-cyano-5-thiazolecarboxylate is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure allows for potential applications in the synthesis of agrochemicals and pharmaceuticals, particularly in the development of compounds with antimicrobial or antifungal properties. As with many thiazole derivatives, it may also serve as a building block in organic synthesis, facilitating the creation of more complex molecules. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C6H4N2O2S
InChI:InChI=1S/C6H4N2O2S/c1-10-6(9)4-3-8-5(2-7)11-4/h3H,1H3
InChI key:InChIKey=FCQVJJSVVGSALF-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1SC(C#N)=NC1
Synonyms:
  • Methyl 2-cyano-5-thiazolecarboxylate
  • 5-Thiazolecarboxylic acid, 2-cyano-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.