
CAS 1211568-41-0
:2-[(3-Piperidinylmethyl)thio]benzothiazole
Description:
2-[(3-Piperidinylmethyl)thio]benzothiazole is a chemical compound characterized by its unique structure, which combines a benzothiazole moiety with a piperidinylmethylthio group. This compound typically exhibits properties associated with both heterocyclic and sulfur-containing compounds, making it of interest in various fields, including medicinal chemistry. The presence of the benzothiazole ring contributes to its potential biological activity, as benzothiazoles are known for their roles in pharmaceuticals, particularly as antimicrobial and anticancer agents. The piperidine group enhances its solubility and may influence its pharmacokinetic properties. Additionally, the thioether linkage can affect the compound's reactivity and stability. Overall, 2-[(3-Piperidinylmethyl)thio]benzothiazole is a compound that may exhibit significant biological activity, warranting further investigation for potential therapeutic applications. As with any chemical substance, safety data and handling precautions should be considered when working with this compound in a laboratory setting.
Formula:C13H16N2S2
InChI:InChI=1S/C13H16N2S2/c1-2-6-12-11(5-1)15-13(17-12)16-9-10-4-3-7-14-8-10/h1-2,5-6,10,14H,3-4,7-9H2
InChI key:InChIKey=BZEXKGAVSPYHLY-UHFFFAOYSA-N
SMILES:S(CC1CCCNC1)C2=NC=3C(S2)=CC=CC3
Synonyms:- 2-[(3-Piperidinylmethyl)thio]benzothiazole
- Benzothiazole, 2-[(3-piperidinylmethyl)thio]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.