CymitQuimica logo

CAS 1211578-93-6

:

6-Chloro-5-(trifluoromethyl)pyridin-3-ol

Description:
6-Chloro-5-(trifluoromethyl)pyridin-3-ol is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a chloro group at the 6-position and a trifluoromethyl group at the 5-position significantly influences its chemical properties and reactivity. The hydroxyl group (-OH) at the 3-position contributes to its potential as a phenolic compound, which can participate in hydrogen bonding and may exhibit varying degrees of acidity. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its trifluoromethyl group enhances lipophilicity and can improve biological activity. Additionally, the chlorine substituent can affect the compound's electronic properties, making it a subject of interest in medicinal chemistry. Overall, 6-Chloro-5-(trifluoromethyl)pyridin-3-ol is notable for its unique structural features and potential applications in various chemical fields.
Formula:C6H3ClF3NO
InChI:InChI=1S/C6H3ClF3NO/c7-5-4(6(8,9)10)1-3(12)2-11-5/h1-2,12H
InChI key:YPZNWJDFGOYBMM-UHFFFAOYSA-N
SMILES:C1=C(C=NC(=C1C(F)(F)F)Cl)O
Found 4 products.