CymitQuimica logo

CAS 1211579-16-6

:

7-Chloro-1,3-dioxolo[4,5-b]pyridine

Description:
7-Chloro-1,3-dioxolo[4,5-b]pyridine is a heterocyclic compound characterized by its unique bicyclic structure, which includes a pyridine ring fused with a dioxole moiety. This compound features a chlorine substituent at the 7-position of the pyridine ring, which can influence its reactivity and biological activity. The presence of the dioxole group contributes to its potential as a versatile building block in organic synthesis and medicinal chemistry. Typically, compounds of this nature exhibit interesting pharmacological properties, making them subjects of research in drug development. The molecular structure suggests potential interactions with biological targets, and the chlorine atom may enhance lipophilicity or alter the electronic properties of the molecule. As with many heterocycles, the compound may also exhibit distinct solubility characteristics, stability under various conditions, and specific reactivity patterns, which are crucial for its applications in chemical synthesis and potential therapeutic uses. Further studies would be necessary to fully elucidate its properties and applications in various fields.
Formula:C6H4ClNO2
InChI:InChI=1S/C6H4ClNO2/c7-4-1-2-8-6-5(4)9-3-10-6/h1-2H,3H2
InChI key:InChIKey=GKLODDQVVDJEII-UHFFFAOYSA-N
SMILES:ClC1=C2C(=NC=C1)OCO2
Synonyms:
  • 1,3-Dioxolo[4,5-b]pyridine, 7-chloro-
  • 7-Chloro-1,3-dioxolo[4,5-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.