
CAS 1211579-80-4
:5-Ethyl-3-pyridinemethanamine
Description:
5-Ethyl-3-pyridinemethanamine, with the CAS number 1211579-80-4, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an ethyl group and an amine functional group, contributing to its chemical reactivity and potential applications. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the amine group suggests that it can participate in hydrogen bonding, influencing its solubility in polar solvents. Additionally, the ethyl substituent can affect the compound's lipophilicity, making it relevant in medicinal chemistry and drug design. Its structural characteristics may also impart biological activity, making it of interest in pharmaceutical research. However, specific physical properties such as melting point, boiling point, and solubility would need to be referenced from experimental data or literature for precise applications. Safety data should also be consulted to understand any potential hazards associated with handling this compound.
Formula:C8H12N2
InChI:InChI=1S/C8H12N2/c1-2-7-3-8(4-9)6-10-5-7/h3,5-6H,2,4,9H2,1H3
InChI key:InChIKey=IXXNMFUPRPNCPP-UHFFFAOYSA-N
SMILES:C(C)C=1C=C(CN)C=NC1
Synonyms:- 5-Ethyl-3-pyridinemethanamine
- (5-Ethylpyridin-3-yl)methanamine
- 3-Pyridinemethanamine, 5-ethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.