
CAS 1211580-24-3
:6-(4-Methyl-1-piperazinyl)-2-pyrazinemethanamine
Description:
6-(4-Methyl-1-piperazinyl)-2-pyrazinemethanamine, identified by its CAS number 1211580-24-3, is a chemical compound characterized by its unique structural features, which include a pyrazine ring and a piperazine moiety. This compound typically exhibits properties associated with amines, such as basicity due to the presence of nitrogen atoms. The piperazine group contributes to its potential biological activity, making it of interest in pharmaceutical research. The presence of the methyl group on the piperazine ring can influence its lipophilicity and solubility, affecting its pharmacokinetic properties. Additionally, the pyrazine ring may participate in various chemical interactions, including hydrogen bonding and π-π stacking, which can be crucial for its activity in biological systems. Overall, this compound's characteristics suggest potential applications in medicinal chemistry, particularly in the development of therapeutic agents targeting specific biological pathways. Further studies would be necessary to elucidate its full range of properties and potential uses.
Formula:C10H17N5
InChI:InChI=1S/C10H17N5/c1-14-2-4-15(5-3-14)10-8-12-7-9(6-11)13-10/h7-8H,2-6,11H2,1H3
InChI key:InChIKey=DKRHISUXHRGPBG-UHFFFAOYSA-N
SMILES:C(N)C=1N=C(C=NC1)N2CCN(C)CC2
Synonyms:- 2-Pyrazinemethanamine, 6-(4-methyl-1-piperazinyl)-
- 6-(4-Methyl-1-piperazinyl)-2-pyrazinemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.