CAS 1211580-39-0

4,6-Dichloro-3-(1-methylethyl)-1H-pyrazolo[3,4-d]pyrimidine

Description:

4,6-Dichloro-3-(1-methylethyl)-1H-pyrazolo[3,4-d]pyrimidine is a heterocyclic compound characterized by its pyrazolo-pyrimidine structure, which incorporates both pyrazole and pyrimidine rings. This compound features two chlorine atoms at the 4 and 6 positions, contributing to its reactivity and potential biological activity. The presence of the isopropyl group at the 3-position enhances its lipophilicity, which may influence its pharmacokinetic properties. Typically, such compounds are of interest in medicinal chemistry due to their potential as bioactive agents, particularly in the development of pharmaceuticals targeting various biological pathways. The compound's molecular structure suggests it may exhibit specific interactions with biological targets, making it a candidate for further research in drug discovery. Additionally, its synthesis and characterization would involve standard organic chemistry techniques, and its stability and solubility would be important factors to consider in practical applications. Overall, 4,6-Dichloro-3-(1-methylethyl)-1H-pyrazolo[3,4-d]pyrimidine represents a class of compounds with significant potential in various chemical and biological fields.

Formula: C₈H₈Cl₂N₄

InChI: InChI=1S/C8H8Cl2N4/c1-3(2)5-4-6(9)11-8(10)12-7(4)14-13-5/h3H,1-2H3,(H,11,12,13,14)

InChI key: InChIKey=HJCVCIYLKUNPOS-UHFFFAOYSA-N

SMILES: C(C)(C)C=1C=2C(=NC(Cl)=NC2Cl)NN1

Synonyms:

• 4,6-Dichloro-3-(1-methylethyl)-1H-pyrazolo[3,4-d]pyrimidine
• 1H-Pyrazolo[3,4-d]pyrimidine, 4,6-dichloro-3-(1-methylethyl)-