
CAS 1211580-85-6
:Piperazine, 1-[(6-methyl-3-pyridinyl)methyl]-
Description:
Piperazine, 1-[(6-methyl-3-pyridinyl)methyl]- is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a 6-methyl-3-pyridinyl group attached to the piperazine, contributing to its unique properties and potential biological activity. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of nitrogen atoms, which can engage in hydrogen bonding. The presence of the pyridine ring suggests potential interactions with biological systems, making it of interest in medicinal chemistry and pharmacology. Its structure may influence its reactivity, stability, and interaction with various biological targets. As with many piperazine derivatives, it may possess psychoactive or therapeutic properties, although specific biological activities would require further investigation. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C11H17N3
InChI:InChI=1S/C11H17N3/c1-10-2-3-11(8-13-10)9-14-6-4-12-5-7-14/h2-3,8,12H,4-7,9H2,1H3
InChI key:InChIKey=WARIMOYXTMFETA-UHFFFAOYSA-N
SMILES:C(C=1C=CC(C)=NC1)N2CCNCC2
Synonyms:- 1-(6-Methyl-pyridin-3-ylmethyl)-piperazine
- Piperazine, 1-[(6-methyl-3-pyridinyl)methyl]-
- 1-[(6-Methylpyridin-3-yl)methyl]piperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.