CAS 1211581-63-3

1,6-Dihydro-6-oxo-5-pyrimidinesulfonyl chloride

Description:

1,6-Dihydro-6-oxo-5-pyrimidinesulfonyl chloride is a chemical compound characterized by its pyrimidine ring structure, which features a sulfonyl chloride functional group. This compound typically exhibits properties associated with both heterocyclic compounds and sulfonyl chlorides, such as reactivity towards nucleophiles due to the presence of the sulfonyl chloride group. It is likely to be a solid at room temperature, with potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. The presence of the carbonyl group contributes to its reactivity, allowing it to participate in various chemical reactions, including acylation and substitution reactions. Additionally, the compound may exhibit moderate to high solubility in polar organic solvents, which is common for similar heterocyclic compounds. Safety precautions should be taken when handling this substance, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or moisture. Overall, 1,6-Dihydro-6-oxo-5-pyrimidinesulfonyl chloride is a versatile intermediate in synthetic chemistry.

Formula: C₄H₃ClN₂O₃S

InChI: InChI=1S/C4H3ClN2O3S/c5-11(9,10)3-1-6-2-7-4(3)8/h1-2H,(H,6,7,8)

InChI key: InChIKey=ZIQHCWGTKQAUMZ-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C=1C(=O)NC=NC1

Synonyms:

• 5-Pyrimidinesulfonyl chloride, 1,6-dihydro-6-oxo-
• 1,6-Dihydro-6-oxo-5-pyrimidinesulfonyl chloride