CymitQuimica logo

CAS 1211582-14-7

:

7-Chloro-5-methylthieno[3,2-b]pyridine

Description:
7-Chloro-5-methylthieno[3,2-b]pyridine is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both a thieno and a pyridine ring. This compound features a chlorine atom at the 7-position and a methyl group at the 5-position of the thieno ring, contributing to its chemical reactivity and potential biological activity. The presence of the chlorine atom can enhance lipophilicity and influence the compound's interaction with biological targets. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both sulfur and nitrogen atoms, which are often associated with bioactive compounds. Additionally, its unique structural features may impart specific pharmacological properties, making it a subject of interest in drug discovery and development. As with many heterocycles, the compound's reactivity can be influenced by the electronic properties of the substituents and the overall molecular geometry.
Formula:C8H6ClNS
InChI:InChI=1S/C8H6ClNS/c1-5-4-6(9)8-7(10-5)2-3-11-8/h2-4H,1H3
InChI key:InChIKey=GSHPWKBMGZCIFK-UHFFFAOYSA-N
SMILES:ClC1=C2C(=NC(C)=C1)C=CS2
Synonyms:
  • 7-Chloro-5-methylthieno[3,2-b]pyridine
  • Thieno[3,2-b]pyridine, 7-chloro-5-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.