CymitQuimica logo

CAS 1211582-73-8

:

2-Amino-5-cyclopropyl-3-pyridinecarbonitrile

Description:
2-Amino-5-cyclopropyl-3-pyridinecarbonitrile is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of an amino group (-NH2) at the 2-position and a cyano group (-C≡N) at the 3-position contributes to its reactivity and potential applications in medicinal chemistry. The cyclopropyl group at the 5-position introduces unique steric and electronic properties, which can influence the compound's biological activity and interaction with various targets. This compound may exhibit properties such as solubility in polar solvents, and its structural features suggest potential use in the development of pharmaceuticals, particularly in the field of neuropharmacology or as a building block for more complex molecules. The specific characteristics, such as melting point, boiling point, and spectral data, would require experimental determination or reference to literature for precise values. Overall, 2-Amino-5-cyclopropyl-3-pyridinecarbonitrile represents a versatile scaffold for further chemical exploration and development.
Formula:C9H9N3
InChI:InChI=1S/C9H9N3/c10-4-7-3-8(6-1-2-6)5-12-9(7)11/h3,5-6H,1-2H2,(H2,11,12)
InChI key:InChIKey=TVIBXRMHZQEDKO-UHFFFAOYSA-N
SMILES:C(#N)C1=CC(=CN=C1N)C2CC2
Synonyms:
  • 2-Amino-5-cyclopropylnicotinonitrile
  • 2-Amino-5-cyclopropyl-3-pyridinecarbonitrile
  • 3-Pyridinecarbonitrile, 2-amino-5-cyclopropyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.