CAS 1211582-77-2

4-(Difluoromethyl)-2-pyridinecarbonitrile

Description:

4-(Difluoromethyl)-2-pyridinecarbonitrile is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a difluoromethyl group (-CF2H) at the 4-position and a cyano group (-C≡N) at the 2-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. It exhibits moderate polarity due to the electronegative fluorine atoms and the cyano group, which can influence its solubility in various organic solvents. The compound may participate in nucleophilic reactions due to the electron-withdrawing nature of the cyano group, making it a potential intermediate in the synthesis of pharmaceuticals or agrochemicals. Additionally, its fluorinated structure may impart desirable characteristics such as increased metabolic stability or altered lipophilicity in biological systems. Safety data should be consulted, as fluorinated compounds can exhibit unique toxicological profiles.

Formula: C₇H₄F₂N₂

InChI: InChI=1S/C7H4F2N2/c8-7(9)5-1-2-11-6(3-5)4-10/h1-3,7H

InChI key: InChIKey=OUHYVRDBTSLOGT-UHFFFAOYSA-N

SMILES: C(F)(F)C=1C=C(C#N)N=CC1

Synonyms:

• 4-(Difluoromethyl)-2-pyridinecarbonitrile
• 2-Pyridinecarbonitrile, 4-(difluoromethyl)-