CymitQuimica logo

CAS 1211582-86-3

:

4,6-Dichloro-3-(trifluoromethyl)-1H-pyrazolo[3,4-d]pyrimidine

Description:
4,6-Dichloro-3-(trifluoromethyl)-1H-pyrazolo[3,4-d]pyrimidine is a heterocyclic compound characterized by its pyrazolo-pyrimidine structure, which incorporates both pyrazole and pyrimidine rings. This compound features two chlorine atoms at the 4 and 6 positions and a trifluoromethyl group at the 3 position, contributing to its unique chemical properties. It is typically a solid at room temperature and exhibits moderate solubility in organic solvents. The presence of halogen substituents enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound is of interest in medicinal chemistry and agrochemicals due to its potential biological activity, particularly in the development of pharmaceuticals. Its molecular structure allows for interactions with biological targets, which can lead to various pharmacological effects. Safety data should be consulted for handling and usage, as halogenated compounds can pose environmental and health risks.
Formula:C6HCl2F3N4
InChI:InChI=1S/C6HCl2F3N4/c7-3-1-2(6(9,10)11)14-15-4(1)13-5(8)12-3/h(H,12,13,14,15)
InChI key:InChIKey=AJGYNOJYEZFWBJ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C=2C(NN1)=NC(Cl)=NC2Cl
Synonyms:
  • 1H-Pyrazolo[3,4-d]pyrimidine, 4,6-dichloro-3-(trifluoromethyl)-
  • 4,6-Dichloro-3-(trifluoromethyl)-1H-pyrazolo[3,4-d]pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.