CymitQuimica logo

CAS 1211582-98-7

:

9-Methyl-2,9-diazaspiro[5.5]undecane

Description:
9-Methyl-2,9-diazaspiro[5.5]undecane is a bicyclic organic compound characterized by its unique spiro structure, which consists of two interconnected rings sharing a single atom. This compound features a nitrogen atom in both of its spiro centers, contributing to its diaza designation. The presence of a methyl group at the 9-position enhances its steric and electronic properties, potentially influencing its reactivity and interactions with biological systems. The spiro configuration often results in distinctive three-dimensional conformations, which can affect the compound's physical properties, such as solubility and boiling point. Additionally, the nitrogen atoms may impart basicity and potential for hydrogen bonding, making it of interest in medicinal chemistry and material science. The compound's CAS number, 1211582-98-7, allows for precise identification and retrieval of information in chemical databases. Overall, 9-Methyl-2,9-diazaspiro[5.5]undecane represents a fascinating example of spirocyclic chemistry with potential applications in various fields.
Formula:C10H20N2
InChI:InChI=1S/C10H20N2/c1-12-7-4-10(5-8-12)3-2-6-11-9-10/h11H,2-9H2,1H3
InChI key:InChIKey=DPAUGPILPAZRRD-UHFFFAOYSA-N
SMILES:CN1CCC2(CC1)CCCNC2
Synonyms:
  • 9-Methyl-2,9-diazaspiro[5.5]undecane
  • 2,9-Diazaspiro[5.5]undecane, 9-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.