CAS 1211583-89-9: 4-Bromo-5-methyl-2-(trifluoromethyl)pyridine

Description:4-Bromo-5-methyl-2-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 4-position and a methyl group at the 5-position, along with a trifluoromethyl group at the 2-position, contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its form, and is known for its relatively high stability due to the aromatic nature of the pyridine ring. The trifluoromethyl group enhances its lipophilicity and can influence its reactivity, making it useful in various chemical syntheses and applications, particularly in pharmaceuticals and agrochemicals. Additionally, the presence of halogens can impart specific biological activities, making this compound of interest in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.

Formula:C₇H₅BrF₃N

InChI:InChI=1S/C7H5BrF3N/c1-4-3-12-6(2-5(4)8)7(9,10)11/h2-3H,1H3

InChI key:InChIKey=LZJDDJVGIIVJJG-UHFFFAOYSA-N

SMILES:FC(F)(F)C1=NC=C(C(Br)=C1)C