CAS 1211583-97-9

3-Chloro-2-pyrazinesulfonyl chloride

Description:

3-Chloro-2-pyrazinesulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and ability to form sulfonamides. This compound features a pyrazine ring, a six-membered aromatic heterocycle containing two nitrogen atoms, which contributes to its unique chemical properties. The presence of the chlorine atom at the 3-position of the pyrazine ring enhances its electrophilic character, making it useful in various synthetic applications, particularly in the preparation of pharmaceuticals and agrochemicals. As a sulfonyl chloride, it is typically a colorless to pale yellow liquid or solid, depending on its form, and is sensitive to moisture, requiring careful handling and storage. It is often used as a reagent in organic synthesis, facilitating the introduction of sulfonyl groups into other molecules. Safety precautions are essential when working with this compound due to its corrosive nature and potential to release toxic gases upon reaction with water or amines.

Formula: C₄H₂Cl₂N₂O₂S

InChI: InChI=1S/C4H2Cl2N2O2S/c5-3-4(11(6,9)10)8-2-1-7-3/h1-2H

InChI key: InChIKey=QELLFVPWUTYQBS-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C=1C(Cl)=NC=CN1

Synonyms:

• 3-Chloro-2-pyrazinesulfonyl chloride
• 2-Pyrazinesulfonyl chloride, 3-chloro-