CAS 1211584-26-7

5-Fluoro-2-(2-pyrrolidinyl)pyridine

Description:

5-Fluoro-2-(2-pyrrolidinyl)pyridine is a chemical compound characterized by its pyridine ring structure, which is substituted with a fluorine atom and a pyrrolidine group. The presence of the fluorine atom enhances the compound's lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The pyrrolidine moiety contributes to the compound's potential as a ligand in various biological systems, possibly affecting receptor interactions or enzyme inhibition. This compound is typically studied for its pharmacological properties, particularly in the context of neuropharmacology and drug development. Its molecular structure suggests potential applications in the synthesis of more complex molecules or as a building block in the development of pharmaceuticals. Additionally, the compound's stability, solubility, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many fluorinated compounds, it may exhibit unique properties that differentiate it from its non-fluorinated analogs, making it a subject of interest in both academic and industrial research.

Formula: C₉H₁₁FN₂

InChI: InChI=1S/C9H11FN2/c10-7-3-4-9(12-6-7)8-2-1-5-11-8/h3-4,6,8,11H,1-2,5H2

InChI key: InChIKey=HMSQFFINRZJSLM-UHFFFAOYSA-N

SMILES: FC1=CC=C(N=C1)C2CCCN2

Synonyms:

• Pyridine, 5-fluoro-2-(2-pyrrolidinyl)-
• 5-Fluoro-2-(2-pyrrolidinyl)pyridine