CymitQuimica logo

CAS 1211584-36-9

:

3-Methyl-6-(trifluoromethyl)-2-pyridinecarboxylic acid

Description:
3-Methyl-6-(trifluoromethyl)-2-pyridinecarboxylic acid is an aromatic carboxylic acid characterized by its pyridine ring, which is a six-membered heterocyclic compound containing one nitrogen atom. The presence of a methyl group at the 3-position and a trifluoromethyl group at the 6-position significantly influences its chemical properties, including its acidity and lipophilicity. This compound typically exhibits moderate solubility in polar solvents due to the carboxylic acid functional group, while the trifluoromethyl group enhances its electron-withdrawing characteristics, potentially increasing acidity. The compound may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it useful in synthetic organic chemistry. Additionally, its unique structure may impart specific biological activities, making it of interest in pharmaceutical research. Safety data should be consulted for handling, as the trifluoromethyl group can contribute to toxicity and environmental concerns. Overall, 3-Methyl-6-(trifluoromethyl)-2-pyridinecarboxylic acid is a versatile compound with applications in both research and industry.
Formula:C8H6F3NO2
InChI:InChI=1S/C8H6F3NO2/c1-4-2-3-5(8(9,10)11)12-6(4)7(13)14/h2-3H,1H3,(H,13,14)
InChI key:InChIKey=RQNQITWZEDOKNV-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1N=C(C(F)(F)F)C=CC1C
Synonyms:
  • 2-Pyridinecarboxylic acid, 3-methyl-6-(trifluoromethyl)-
  • 3-Methyl-6-(trifluoromethyl)-2-pyridinecarboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.