
CAS 1211584-41-6
:1-[(2-Chloro-3-pyridinyl)methyl]piperazine
Description:
1-[(2-Chloro-3-pyridinyl)methyl]piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a 2-chloro-3-pyridinyl group indicates that the compound has a pyridine ring substituted with a chlorine atom, contributing to its potential biological activity. This compound is typically classified as an organic heterocyclic compound due to the inclusion of nitrogen in its structure. It may exhibit properties such as solubility in polar solvents, and its reactivity can be influenced by the functional groups present. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as piperazine derivatives are often explored for their therapeutic effects. Additionally, the chlorine substituent may enhance the compound's lipophilicity and influence its interaction with biological targets. Overall, 1-[(2-Chloro-3-pyridinyl)methyl]piperazine is of interest in various fields, including drug discovery and development.
Formula:C10H14ClN3
InChI:InChI=1S/C10H14ClN3/c11-10-9(2-1-3-13-10)8-14-6-4-12-5-7-14/h1-3,12H,4-8H2
InChI key:InChIKey=CDVWCPONTZDWKA-UHFFFAOYSA-N
SMILES:C(C1=C(Cl)N=CC=C1)N2CCNCC2
Synonyms:- Piperazine, 1-[(2-chloro-3-pyridinyl)methyl]-
- 1-[(2-Chloro-3-pyridinyl)methyl]piperazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.