
CAS 1211585-00-0
:5-(Chloromethyl)-2-methoxy-4-(trifluoromethyl)pyridine
Description:
5-(Chloromethyl)-2-methoxy-4-(trifluoromethyl)pyridine is a pyridine derivative characterized by the presence of a chloromethyl group, a methoxy group, and a trifluoromethyl group attached to the pyridine ring. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as dichloromethane and acetone, but may have limited solubility in water due to its hydrophobic groups. The trifluoromethyl group contributes to its lipophilicity and can enhance biological activity, making it of interest in medicinal chemistry. The chloromethyl group can serve as a reactive site for further chemical modifications, allowing for the synthesis of more complex molecules. Additionally, the methoxy group can influence the electronic properties of the molecule, potentially affecting its reactivity and interaction with biological targets. Overall, this compound's unique functional groups and structural features make it a valuable candidate for research in pharmaceuticals and agrochemicals.
Formula:C8H7ClF3NO
InChI:InChI=1S/C8H7ClF3NO/c1-14-7-2-6(8(10,11)12)5(3-9)4-13-7/h2,4H,3H2,1H3
InChI key:InChIKey=DRGRKZIYEYWUTJ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1C(CCl)=CN=C(OC)C1
Synonyms:- 5-(Chloromethyl)-2-methoxy-4-(trifluoromethyl)pyridine
- Pyridine, 5-(chloromethyl)-2-methoxy-4-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.