
CAS 1211585-12-4
:5-(Methylamino)-3-pyridinecarbonitrile
Description:
5-(Methylamino)-3-pyridinecarbonitrile is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a methylamino group (-NH(CH3)2) at the 5-position and a cyano group (-C≡N) at the 3-position of the pyridine ring contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents due to the presence of the polar cyano and amino groups. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the functional groups can participate in various chemical reactions and interactions. Additionally, the compound may exhibit biological activity, making it of interest for further research in drug discovery. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices.
Formula:C7H7N3
InChI:InChI=1S/C7H7N3/c1-9-7-2-6(3-8)4-10-5-7/h2,4-5,9H,1H3
InChI key:InChIKey=CLSRDQRRVTZKKV-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C(NC)C=NC1
Synonyms:- 5-(Methylamino)-3-pyridinecarbonitrile
- 3-Pyridinecarbonitrile, 5-(methylamino)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.