CAS 1211585-30-6

1′,2′-Dihydro-5′-(trifluoromethyl)spiro[cyclopropane-1,3′-[3H]indole]

Description:

1′,2′-Dihydro-5′-(trifluoromethyl)spiro[cyclopropane-1,3′-[3H]indole] is a chemical compound characterized by its unique spirocyclic structure, which consists of a cyclopropane ring fused to an indole moiety. The presence of a trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. This compound typically exhibits properties such as moderate to high stability under standard conditions, although specific reactivity can depend on the functional groups present. Its spiro structure may impart distinctive conformational characteristics, potentially affecting its interaction with biological targets. The compound's CAS number, 1211585-30-6, allows for precise identification in chemical databases. While specific applications may vary, compounds of this nature are often explored for their potential in drug development, particularly in areas such as neuropharmacology or as inhibitors in various biochemical pathways. Overall, the unique structural features and functional groups of this compound contribute to its significance in chemical research and potential therapeutic applications.

Formula: C₁₁H₁₀F₃N

InChI: InChI=1S/C11H10F3N/c12-11(13,14)7-1-2-9-8(5-7)10(3-4-10)6-15-9/h1-2,5,15H,3-4,6H2

InChI key: InChIKey=LVUMLLFXMSVXBR-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C2C3(CC3)CNC2=CC1

Synonyms:

• 1′,2′-Dihydro-5′-(trifluoromethyl)spiro[cyclopropane-1,3′-[3H]indole]
• Spiro[cyclopropane-1,3′-[3H]indole], 1′,2′-dihydro-5′-(trifluoromethyl)-