
CAS 1211585-31-7
:3-(2-Oxo-1-piperazinyl)benzonitrile
Description:
3-(2-Oxo-1-piperazinyl)benzonitrile is a chemical compound characterized by its unique structure, which includes a benzonitrile moiety and a piperazine ring with a ketone functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential for diverse reactivity. The presence of the nitrile group suggests that it may participate in nucleophilic addition reactions, while the piperazine ring can influence its solubility and biological activity. Additionally, the ketone functionality may contribute to hydrogen bonding capabilities, affecting its interactions in various environments. This compound is of interest in medicinal chemistry, particularly for its potential pharmacological applications, as piperazine derivatives are often explored for their therapeutic properties. Overall, 3-(2-Oxo-1-piperazinyl)benzonitrile represents a versatile scaffold for further chemical modifications and investigations in drug development.
Formula:C11H11N3O
InChI:InChI=1S/C11H11N3O/c12-7-9-2-1-3-10(6-9)14-5-4-13-8-11(14)15/h1-3,6,13H,4-5,8H2
InChI key:InChIKey=OIJXIBSILNWPPU-UHFFFAOYSA-N
SMILES:O=C1N(C2=CC(C#N)=CC=C2)CCNC1
Synonyms:- Benzonitrile, 3-(2-oxo-1-piperazinyl)-
- 3-(2-Oxo-1-piperazinyl)benzonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.