CymitQuimica logo

CAS 1211587-04-0

:

3-Bromo-5-methoxy-2-pyridinecarboxaldehyde

Description:
3-Bromo-5-methoxy-2-pyridinecarboxaldehyde is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 3-position and a methoxy group at the 5-position contributes to its unique reactivity and properties. The aldehyde functional group at the 2-position makes it a versatile intermediate in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure allows for potential hydrogen bonding and dipole interactions, influencing its physical properties such as boiling and melting points. Additionally, the bromine substituent can participate in electrophilic aromatic substitution reactions, while the methoxy group can enhance nucleophilicity. Overall, 3-Bromo-5-methoxy-2-pyridinecarboxaldehyde is a valuable compound in synthetic organic chemistry, with applications in the development of biologically active molecules.
Formula:C7H6BrNO2
InChI:InChI=1S/C7H6BrNO2/c1-11-5-2-6(8)7(4-10)9-3-5/h2-4H,1H3
InChI key:InChIKey=ZDCQVGSEFVCLFH-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(Br)C(C=O)=NC1
Synonyms:
  • 3-Bromo-5-methoxy-2-pyridinecarboxaldehyde
  • 2-Pyridinecarboxaldehyde, 3-bromo-5-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.