
CAS 1211587-18-6
:2-(1,3-Dioxolan-2-yl)-4-pyridinecarboxaldehyde
Description:
2-(1,3-Dioxolan-2-yl)-4-pyridinecarboxaldehyde is an organic compound characterized by its unique structural features, which include a pyridine ring and a dioxolane moiety. The presence of the aldehyde functional group contributes to its reactivity, making it a potential candidate for various chemical reactions, including condensation and nucleophilic addition. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in polar organic solvents, which enhances its utility in synthetic organic chemistry. The dioxolane ring provides stability and can influence the compound's electronic properties, potentially affecting its reactivity and interactions with other molecules. Due to its structural characteristics, this compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H9NO3
InChI:InChI=1S/C9H9NO3/c11-6-7-1-2-10-8(5-7)9-12-3-4-13-9/h1-2,5-6,9H,3-4H2
InChI key:InChIKey=NBSNTZGONDELPL-UHFFFAOYSA-N
SMILES:C(=O)C=1C=C(N=CC1)C2OCCO2
Synonyms:- 2-(1,3-Dioxolan-2-yl)-4-pyridinecarboxaldehyde
- 4-Pyridinecarboxaldehyde, 2-(1,3-dioxolan-2-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.