CymitQuimica logo

CAS 1211587-21-1

:

5-(Difluoromethyl)-2-pyridineacetic acid

Description:
5-(Difluoromethyl)-2-pyridineacetic acid is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a difluoromethyl group (-CF2H) attached to the 5-position of the pyridine ring and a carboxylic acid functional group (-COOH) at the 2-position. The presence of the difluoromethyl group imparts unique electronic and steric properties, potentially influencing the compound's reactivity and interactions with biological targets. The carboxylic acid group contributes to its acidity and solubility in polar solvents. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure allows for potential applications in drug development, particularly in the design of compounds targeting specific biological pathways. As with many pyridine derivatives, it may also participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, which are valuable in synthetic organic chemistry.
Formula:C8H7F2NO2
InChI:InChI=1S/C8H7F2NO2/c9-8(10)5-1-2-6(11-4-5)3-7(12)13/h1-2,4,8H,3H2,(H,12,13)
InChI key:InChIKey=MHQBHSBQZIWMSH-UHFFFAOYSA-N
SMILES:C(C(O)=O)C1=CC=C(C(F)F)C=N1
Synonyms:
  • 2-Pyridineacetic acid, 5-(difluoromethyl)-
  • 5-(Difluoromethyl)-2-pyridineacetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.