
CAS 1211587-61-9
:2-(1H-Tetrazol-1-yl)-5-pyrimidinamine
Description:
2-(1H-Tetrazol-1-yl)-5-pyrimidinamine is a chemical compound characterized by its unique structure, which includes a tetrazole ring and a pyrimidine moiety. The presence of the tetrazole group contributes to its potential as a bioactive molecule, often associated with various pharmacological activities. This compound typically exhibits good solubility in polar solvents, which can enhance its bioavailability in biological systems. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. The compound may also display properties such as moderate to high stability under standard conditions, although specific stability data would depend on environmental factors. Additionally, the presence of amino groups in its structure can facilitate hydrogen bonding, influencing its reactivity and interaction with other molecules. Overall, 2-(1H-Tetrazol-1-yl)-5-pyrimidinamine is a versatile compound with potential applications in drug development and research, particularly in the fields of pharmacology and biochemistry.
Formula:C5H5N7
InChI:InChI=1S/C5H5N7/c6-4-1-7-5(8-2-4)12-3-9-10-11-12/h1-3H,6H2
InChI key:InChIKey=GTOUEHAIIUSBRY-UHFFFAOYSA-N
SMILES:NC=1C=NC(=NC1)N2C=NN=N2
Synonyms:- 2-(1H-Tetrazol-1-yl)pyrimidin-5-amine
- 2-(1H-1,2,3,4-Tetrazol-1-yl)pyrimidin-5-amine
- 2-(1H-Tetrazol-1-yl)-5-pyrimidinamine
- 5-Pyrimidinamine, 2-(1H-tetrazol-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.