CymitQuimica logo

CAS 1211587-93-7

:

6,7-Dihydro-2-methyl-5H-pyrrolo[3,4-b]pyridine

Description:
6,7-Dihydro-2-methyl-5H-pyrrolo[3,4-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings. This compound features a dihydro structure, indicating the presence of two hydrogen atoms that contribute to its saturation. The methyl group at the 2-position enhances its lipophilicity, potentially influencing its biological activity and solubility properties. The unique bicyclic framework of this compound may impart specific electronic and steric properties, making it of interest in medicinal chemistry and drug development. Its structural characteristics suggest potential interactions with biological targets, which could be explored for therapeutic applications. The compound's CAS number, 1211587-93-7, allows for precise identification in chemical databases and literature. Overall, 6,7-Dihydro-2-methyl-5H-pyrrolo[3,4-b]pyridine represents a class of compounds that may exhibit diverse pharmacological activities, warranting further investigation into its synthesis, reactivity, and potential uses in various fields, including pharmaceuticals and agrochemicals.
Formula:C8H10N2
InChI:InChI=1S/C8H10N2/c1-6-2-3-7-4-9-5-8(7)10-6/h2-3,9H,4-5H2,1H3
InChI key:InChIKey=VLWUYOSNRINVJN-UHFFFAOYSA-N
SMILES:CC=1N=C2C(=CC1)CNC2
Synonyms:
  • 6,7-Dihydro-2-methyl-5H-pyrrolo[3,4-b]pyridine
  • 5H-Pyrrolo[3,4-b]pyridine, 6,7-dihydro-2-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.