CAS 1211588-49-6

Benzene, 1-ethynyl-4,5-difluoro-2-methoxy-

Description:

Benzene, 1-ethynyl-4,5-difluoro-2-methoxy- is an organic compound characterized by its aromatic benzene ring substituted with an ethynyl group, two fluorine atoms, and a methoxy group. The presence of the ethynyl group introduces a triple bond, which contributes to the compound's reactivity and potential applications in organic synthesis. The difluoro substitutions enhance the compound's electronic properties, potentially affecting its reactivity and stability. The methoxy group, being an electron-donating group, can influence the compound's overall polarity and solubility in various solvents. This compound may exhibit interesting chemical behavior due to the interplay of these functional groups, making it relevant in fields such as medicinal chemistry and materials science. Its unique structure may also lead to specific interactions in biological systems or in polymerization processes. As with many fluorinated compounds, it may possess distinct physical properties, such as increased thermal stability and altered volatility compared to non-fluorinated analogs.

Formula: C₉H₆F₂O

InChI: InChI=1S/C9H6F2O/c1-3-6-4-7(10)8(11)5-9(6)12-2/h1,4-5H,2H3

InChI key: InChIKey=CSUPKCQQZVOZQX-UHFFFAOYSA-N

SMILES: C(#C)C1=C(OC)C=C(F)C(F)=C1

Synonyms:

• Benzene, 1-ethynyl-4,5-difluoro-2-methoxy-
• 1-Ethynyl-4,5-difluoro-2-methoxybenzene