CAS 1211588-84-9

7-Chloro-3-phenyl-1H-pyrazolo[4,3-d]pyrimidine

Description:

7-Chloro-3-phenyl-1H-pyrazolo[4,3-d]pyrimidine is a heterocyclic compound characterized by its fused pyrazole and pyrimidine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 7-position and a phenyl group at the 3-position enhances its reactivity and potential biological activity. This compound typically exhibits moderate to high lipophilicity due to the aromatic phenyl group, which can influence its solubility and permeability in biological systems. It may also display interesting pharmacological properties, making it a candidate for research in medicinal chemistry. The structure allows for various interactions with biological targets, potentially leading to applications in drug development. Additionally, its synthesis and characterization involve standard organic chemistry techniques, including reactions that form heterocycles and substitution reactions. Overall, 7-Chloro-3-phenyl-1H-pyrazolo[4,3-d]pyrimidine represents a class of compounds that are of interest for their potential therapeutic applications and as intermediates in organic synthesis.

Formula: C₁₁H₇ClN₄

InChI: InChI=1S/C11H7ClN4/c12-11-10-9(13-6-14-11)8(15-16-10)7-4-2-1-3-5-7/h1-6H,(H,15,16)

SMILES: c1ccc(cc1)c1c2c(c(Cl)ncn2)n[nH]1

Synonyms:

• 1H-Pyrazolo[4,3-d]pyrimidine, 7-chloro-3-phenyl-

7-Chloro-3-phenyl-1H-pyrazolo[4,3-d]pyrimidine

CAS: 1211588-84-9

Formula: C₁₁H₇ClN₄

Molecular weight: 230.6531

Ref: IN-DA00A9XR

7-Chloro-3-phenyl-1H-pyrazolo[4,3-d]pyrimidine

CAS: 1211588-84-9

7-Chloro-3-phenyl-1H-pyrazolo[4,3-d]pyrimidine

Purity: ≥95%

Molecular weight: 230.65g/mol

Ref: 54-OR305504