CAS 1211589-25-1
:3-Bromo-5-methyl-2-(trifluoromethyl)pyridine
Description:
3-Bromo-5-methyl-2-(trifluoromethyl)pyridine is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 3-position and a methyl group at the 5-position, along with a trifluoromethyl group at the 2-position, contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It exhibits moderate polarity due to the electronegative trifluoromethyl group, which can influence its reactivity and solubility in various solvents. The bromine substituent can participate in nucleophilic substitution reactions, while the trifluoromethyl group can enhance the compound's lipophilicity and stability. 3-Bromo-5-methyl-2-(trifluoromethyl)pyridine is of interest in medicinal chemistry and agrochemicals, where it may serve as a building block for more complex molecules or as an active ingredient in various applications.
Formula:C7H5BrF3N
InChI:InChI=1S/C7H5BrF3N/c1-4-2-5(8)6(12-3-4)7(9,10)11/h2-3H,1H3
InChI key:InChIKey=DUPVTQSCCKBORM-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=C(Br)C=C(C)C=N1
Synonyms:- Pyridine, 3-bromo-5-methyl-2-(trifluoromethyl)-
- 3-Bromo-5-methyl-2-(trifluoromethyl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.