CAS 1211589-62-6

4-(4-Nitro-1H-pyrazol-1-yl)piperidine

Description:

4-(4-Nitro-1H-pyrazol-1-yl)piperidine is a chemical compound characterized by its piperidine ring, which is a six-membered saturated heterocycle containing one nitrogen atom. The compound features a 4-nitro-1H-pyrazole moiety, which contributes to its potential biological activity and reactivity. The presence of the nitro group (-NO2) on the pyrazole ring enhances its electrophilic properties, making it a candidate for various chemical reactions. This compound may exhibit interesting pharmacological properties, potentially acting as a ligand or inhibitor in biological systems. Its structure suggests that it could participate in hydrogen bonding and other intermolecular interactions due to the presence of nitrogen atoms. Additionally, the compound's solubility and stability can be influenced by the functional groups present, which may affect its application in medicinal chemistry or material science. As with many nitrogen-containing heterocycles, it may also exhibit unique spectral properties, making it suitable for characterization through techniques such as NMR and mass spectrometry.

Formula: C₈H₁₂N₄O₂

InChI: InChI=1S/C8H12N4O2/c13-12(14)8-5-10-11(6-8)7-1-3-9-4-2-7/h5-7,9H,1-4H2

InChI key: InChIKey=NGFBJMZEUWOGNH-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=CN(N=C1)C2CCNCC2

Synonyms:

• Piperidine, 4-(4-nitro-1H-pyrazol-1-yl)-
• 4-(4-Nitro-1H-pyrazol-1-yl)piperidine