CAS 1211589-64-8

3-Chloro-5-(1H-imidazol-2-yl)pyridine

Description:

3-Chloro-5-(1H-imidazol-2-yl)pyridine is a heterocyclic compound characterized by the presence of both a pyridine and an imidazole ring in its structure. The compound features a chlorine atom at the 3-position of the pyridine ring and an imidazole group at the 5-position, contributing to its unique chemical properties. It is typically a solid at room temperature and exhibits moderate solubility in polar organic solvents. The presence of the chlorine atom enhances its reactivity, making it a useful intermediate in various synthetic applications, particularly in medicinal chemistry and agrochemicals. The imidazole moiety can participate in hydrogen bonding and coordination with metal ions, which may influence its biological activity. This compound may also exhibit antimicrobial or antifungal properties, making it of interest in pharmaceutical research. As with many heterocyclic compounds, its stability and reactivity can be influenced by environmental factors such as pH and temperature. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₈H₆ClN₃

InChI: InChI=1S/C8H6ClN3/c9-7-3-6(4-10-5-7)8-11-1-2-12-8/h1-5H,(H,11,12)

InChI key: InChIKey=OMUNDKCPYZHQMP-UHFFFAOYSA-N

SMILES: ClC1=CC(=CN=C1)C=2NC=CN2

Synonyms:

• 3-Chloro-5-(1H-imidazol-2-yl)pyridine
• Pyridine, 3-chloro-5-(1H-imidazol-2-yl)-