CymitQuimica logo

CAS 1211589-83-1

:

4,5-Dichloro-2-pyrimidinecarbonitrile

Description:
4,5-Dichloro-2-pyrimidinecarbonitrile is a heterocyclic organic compound characterized by the presence of a pyrimidine ring substituted with two chlorine atoms and a cyano group. Its molecular structure features a six-membered aromatic ring containing nitrogen atoms, which contributes to its chemical reactivity and potential applications in various fields. The dichloro substitutions typically enhance the compound's biological activity, making it of interest in pharmaceutical research, particularly in the development of agrochemicals and medicinal compounds. The cyano group introduces a polar functional group, influencing the compound's solubility and reactivity. This substance is generally handled with care due to its potential toxicity and environmental impact. Its synthesis and manipulation require adherence to safety protocols, as with many halogenated compounds. Overall, 4,5-Dichloro-2-pyrimidinecarbonitrile is notable for its unique structural features and potential utility in chemical synthesis and biological applications.
Formula:C5HCl2N3
InChI:InChI=1S/C5HCl2N3/c6-3-2-9-4(1-8)10-5(3)7/h2H
InChI key:InChIKey=JIOMEDVCEASERJ-UHFFFAOYSA-N
SMILES:C(#N)C=1N=C(Cl)C(Cl)=CN1
Synonyms:
  • 2-Pyrimidinecarbonitrile, 4,5-dichloro-
  • 4,5-Dichloro-2-pyrimidinecarbonitrile
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.