
CAS 1211589-94-4
:5-Ethyl-3-pyridinesulfonyl chloride
Description:
5-Ethyl-3-pyridinesulfonyl chloride is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of the ethyl group at the 5-position and the sulfonyl chloride functional group at the 3-position contributes to its reactivity and potential applications in organic synthesis. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its role as a sulfonylating agent, which can introduce sulfonyl groups into various substrates, making it valuable in the synthesis of pharmaceuticals and agrochemicals. The sulfonyl chloride group is highly reactive, particularly with nucleophiles, and can participate in various chemical reactions, including nucleophilic substitution and acylation. Due to its reactivity, appropriate safety measures should be taken when handling this compound, as it can be corrosive and may cause irritation to the skin and eyes.
Formula:C7H8ClNO2S
InChI:InChI=1S/C7H8ClNO2S/c1-2-6-3-7(5-9-4-6)12(8,10)11/h3-5H,2H2,1H3
InChI key:InChIKey=SNSBIMPFYIEINH-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C=1C=C(CC)C=NC1
Synonyms:- 3-Pyridinesulfonyl chloride, 5-ethyl-
- 5-Ethyl-3-pyridinesulfonyl chloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.