CAS 1211590-16-7

Methyl 6-(1-methylethyl)-2-pyridinecarboxylate

Description:

Methyl 6-(1-methylethyl)-2-pyridinecarboxylate, identified by its CAS number 1211590-16-7, is an organic compound belonging to the class of pyridinecarboxylates. This substance features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom, and a carboxylate functional group, indicating its potential for various chemical reactivity. The presence of the isopropyl group (1-methylethyl) at the 6-position of the pyridine ring contributes to its steric and electronic properties, influencing its solubility and reactivity. Methyl esters, such as this compound, are typically characterized by their pleasant odors and are often used in organic synthesis and as intermediates in the production of pharmaceuticals and agrochemicals. The compound's specific physical properties, such as boiling point, melting point, and solubility, would depend on its molecular structure and interactions. Overall, Methyl 6-(1-methylethyl)-2-pyridinecarboxylate is a versatile compound with potential applications in various chemical fields.

Formula: C₁₀H₁₃NO₂

InChI: InChI=1S/C10H13NO2/c1-7(2)8-5-4-6-9(11-8)10(12)13-3/h4-7H,1-3H3

InChI key: InChIKey=TZPRYUFMLBAGFK-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1N=C(C(C)C)C=CC1

Synonyms:

• 2-Pyridinecarboxylic acid, 6-(1-methylethyl)-, methyl ester
• Methyl 6-(1-methylethyl)-2-pyridinecarboxylate