
CAS 1211590-19-0
:Piperidine, 4-(1-methyl-3-pyrrolidinyl)-
Description:
Piperidine, 4-(1-methyl-3-pyrrolidinyl)-, also known by its CAS number 1211590-19-0, is a chemical compound characterized by its bicyclic structure, which includes a piperidine ring and a pyrrolidine moiety. This compound typically exhibits properties associated with nitrogen-containing heterocycles, such as basicity and the ability to participate in hydrogen bonding due to the presence of nitrogen atoms. It is often utilized in organic synthesis and medicinal chemistry, where its structural features can contribute to biological activity. The presence of both piperidine and pyrrolidine rings suggests potential applications in the development of pharmaceuticals, particularly in the design of compounds that interact with neurotransmitter systems. Additionally, the compound may exhibit lipophilicity, influencing its solubility and permeability in biological systems. As with many nitrogenous compounds, it may also display varying degrees of reactivity depending on the functional groups present and the conditions of the reaction environment. Safety data and handling precautions should be observed due to potential toxicity and reactivity.
Formula:C10H20N2
InChI:InChI=1S/C10H20N2/c1-12-7-4-10(8-12)9-2-5-11-6-3-9/h9-11H,2-8H2,1H3
InChI key:InChIKey=HJSRDORSYFMKLS-UHFFFAOYSA-N
SMILES:CN1CC(CC1)C2CCNCC2
Synonyms:- Piperidine, 4-(1-methyl-3-pyrrolidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.